About N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine
N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine (PubChem CID 114597107) has the molecular formula C16H34N2
and a molecular weight of 254.46 g/mol. Its IUPAC name is N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine.
Molecular Properties
| Compound Name | N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine |
| PubChem CID | 114597107 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine |
| SMILES | CCCNCCCC(C)N1CC(C)CC(C)C1C |
| InChI | InChI=1S/C16H34N2/c1-6-9-17-10-7-8-15(4)18-12-13(2)11-14(3)16(18)5/h13-17H,6-12H2,1-5H3 |
| InChIKey | TVHAPZOHHORCCB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine?
The IUPAC name of N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine (CID 114597107) is N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine.
What is the SMILES notation for N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine?
The canonical SMILES for N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine is CCCNCCCC(C)N1CC(C)CC(C)C1C.
What is the InChIKey of N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine?
The InChIKey is TVHAPZOHHORCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2/c1-6-9-17-10-7-8-15(4)18-12-13(2)11-14(3)16(18)5/h13-17H,6-12H2,1-5H3.
What are the key properties of N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine?
N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine has a molecular weight of 254.46 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-4-(2,3,5-trimethylpiperidin-1-yl)pentan-1-amine is sourced from PubChem (CID 114597107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).