About (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone
(2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone (PubChem CID 114602090) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone.
Molecular Properties
| Compound Name | (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone |
| PubChem CID | 114602090 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone |
| SMILES | Cc1cnc(C(=O)c2ccccc2C2CCC2)c(C)c1 |
| InChI | InChI=1S/C18H19NO/c1-12-10-13(2)17(19-11-12)18(20)16-9-4-3-8-15(16)14-6-5-7-14/h3-4,8-11,14H,5-7H2,1-2H3 |
| InChIKey | XSCJVUYUTQYIOJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone?
The IUPAC name of (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone (CID 114602090) is (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone.
What is the SMILES notation for (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone?
The canonical SMILES for (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone is Cc1cnc(C(=O)c2ccccc2C2CCC2)c(C)c1.
What is the InChIKey of (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone?
The InChIKey is XSCJVUYUTQYIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO/c1-12-10-13(2)17(19-11-12)18(20)16-9-4-3-8-15(16)14-6-5-7-14/h3-4,8-11,14H,5-7H2,1-2H3.
What are the key properties of (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone?
(2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone has a molecular weight of 265.36 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclobutylphenyl)-(3,5-dimethyl-2-pyridinyl)methanone is sourced from PubChem (CID 114602090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).