C17H24O2 — CID 114602475
1-(2-cyclobutylphenyl)-2-cyclopropyl-2-ethoxyethanol (PubChem CID 114602475) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(2-cyclobutylphenyl)-2-cyclopropyl-2-ethoxyethanol.
| Compound Name | 1-(2-cyclobutylphenyl)-2-cyclopropyl-2-ethoxyethanol |
|---|---|
| PubChem CID | 114602475 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 1-(2-cyclobutylphenyl)-2-cyclopropyl-2-ethoxyethanol |
| SMILES | CCOC(C1CC1)C(O)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C17H24O2/c1-2-19-17(13-10-11-13)16(18)15-9-4-3-8-14(15)12-6-5-7-12/h3-4,8-9,12-13,16-18H,2,5-7,10-11H2,1H3 |
| InChIKey | XJNVUFFKVRDVLM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |