C14H19N — CID 114602603
(2-cyclobutylphenyl)-cyclopropylmethanamine (PubChem CID 114602603) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (2-cyclobutylphenyl)-cyclopropylmethanamine.
| Compound Name | (2-cyclobutylphenyl)-cyclopropylmethanamine |
|---|---|
| PubChem CID | 114602603 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (2-cyclobutylphenyl)-cyclopropylmethanamine |
| SMILES | NC(c1ccccc1C1CCC1)C1CC1 |
| InChI | InChI=1S/C14H19N/c15-14(11-8-9-11)13-7-2-1-6-12(13)10-4-3-5-10/h1-2,6-7,10-11,14H,3-5,8-9,15H2 |
| InChIKey | QBVVTXZOENEIBU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |