C20H31N — CID 114603457
(2-cyclobutylphenyl)-(4-propan-2-ylcyclohexyl)methanamine (PubChem CID 114603457) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is (2-cyclobutylphenyl)-(4-propan-2-ylcyclohexyl)methanamine.
| Compound Name | (2-cyclobutylphenyl)-(4-propan-2-ylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 114603457 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | (2-cyclobutylphenyl)-(4-propan-2-ylcyclohexyl)methanamine |
| SMILES | CC(C)C1CCC(C(N)c2ccccc2C2CCC2)CC1 |
| InChI | InChI=1S/C20H31N/c1-14(2)15-10-12-17(13-11-15)20(21)19-9-4-3-8-18(19)16-6-5-7-16/h3-4,8-9,14-17,20H,5-7,10-13,21H2,1-2H3 |
| InChIKey | CMDZRFPBDWZJGT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |