C9H8IN3O3 — CID 114604834
4-iodo-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrrole-2-carboxylic acid (PubChem CID 114604834) has the molecular formula C9H8IN3O3 and a molecular weight of 333.09 g/mol. Its IUPAC name is 4-iodo-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrrole-2-carboxylic acid.
| Compound Name | 4-iodo-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114604834 |
| Molecular Formula | C9H8IN3O3 |
| Molecular Weight | 333.09 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 4-iodo-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrrole-2-carboxylic acid |
| SMILES | Cc1noc(Cn2cc(I)cc2C(=O)O)n1 |
| InChI | InChI=1S/C9H8IN3O3/c1-5-11-8(16-12-5)4-13-3-6(10)2-7(13)9(14)15/h2-3H,4H2,1H3,(H,14,15) |
| InChIKey | IKDLPEMRFOHABY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.09 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|