C13H9Cl3N2O3 — CID 114605295
methyl 1-pyridin-3-yl-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate (PubChem CID 114605295) has the molecular formula C13H9Cl3N2O3 and a molecular weight of 347.59 g/mol. Its IUPAC name is methyl 1-pyridin-3-yl-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate.
| Compound Name | methyl 1-pyridin-3-yl-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114605295 |
| Molecular Formula | C13H9Cl3N2O3 |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | methyl 1-pyridin-3-yl-4-(2,2,2-trichloroacetyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(C(=O)C(Cl)(Cl)Cl)cn1-c1cccnc1 |
| InChI | InChI=1S/C13H9Cl3N2O3/c1-21-12(20)10-5-8(11(19)13(14,15)16)7-18(10)9-3-2-4-17-6-9/h2-7H,1H3 |
| InChIKey | UNETVSPZADBDLZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|