C12H13N3O4S — CID 11460631
2-[4-(2-amino-2-oxoethyl)-3-oxo-1,4-benzothiazin-2-yl]-N-hydroxyacetamide (PubChem CID 11460631) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[4-(2-amino-2-oxoethyl)-3-oxo-1,4-benzothiazin-2-yl]-N-hydroxyacetamide.
| Compound Name | 2-[4-(2-amino-2-oxoethyl)-3-oxo-1,4-benzothiazin-2-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 11460631 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-[4-(2-amino-2-oxoethyl)-3-oxo-1,4-benzothiazin-2-yl]-N-hydroxyacetamide |
| SMILES | NC(=O)CN1C(=O)C(CC(=O)NO)Sc2ccccc21 |
| InChI | InChI=1S/C12H13N3O4S/c13-10(16)6-15-7-3-1-2-4-8(7)20-9(12(15)18)5-11(17)14-19/h1-4,9,19H,5-6H2,(H2,13,16)(H,14,17) |
| InChIKey | AWDOSWMBHGGYOW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|