C14H11Cl2NO3 — CID 114606593
4-acetyl-1-(2,5-dichloro-4-methylphenyl)pyrrole-2-carboxylic acid (PubChem CID 114606593) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is 4-acetyl-1-(2,5-dichloro-4-methylphenyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-acetyl-1-(2,5-dichloro-4-methylphenyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114606593 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-acetyl-1-(2,5-dichloro-4-methylphenyl)pyrrole-2-carboxylic acid |
| SMILES | CC(=O)c1cc(C(=O)O)n(-c2cc(Cl)c(C)cc2Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO3/c1-7-3-11(16)12(5-10(7)15)17-6-9(8(2)18)4-13(17)14(19)20/h3-6H,1-2H3,(H,19,20) |
| InChIKey | SQWREBLRCIACBH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |