About 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine
2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine (PubChem CID 114606768) has the molecular formula C16H18ClN3O
and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine |
| PubChem CID | 114606768 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine |
| SMILES | CC(C)Oc1nc(Cl)nc(-c2ccccc2C2CCC2)n1 |
| InChI | InChI=1S/C16H18ClN3O/c1-10(2)21-16-19-14(18-15(17)20-16)13-9-4-3-8-12(13)11-6-5-7-11/h3-4,8-11H,5-7H2,1-2H3 |
| InChIKey | QVIWXMDKGOFEFP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine?
The IUPAC name of 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine (CID 114606768) is 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine?
The canonical SMILES for 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine is CC(C)Oc1nc(Cl)nc(-c2ccccc2C2CCC2)n1.
What is the InChIKey of 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine?
The InChIKey is QVIWXMDKGOFEFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3O/c1-10(2)21-16-19-14(18-15(17)20-16)13-9-4-3-8-12(13)11-6-5-7-11/h3-4,8-11H,5-7H2,1-2H3.
What are the key properties of 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine?
2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine has a molecular weight of 303.79 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(2-cyclobutylphenyl)-6-propan-2-yloxy-1,3,5-triazine is sourced from PubChem (CID 114606768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).