C15H19NOS — CID 114607772
(3-cyclobutylphenyl)-thiomorpholin-3-ylmethanone (PubChem CID 114607772) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-thiomorpholin-3-ylmethanone.
| Compound Name | (3-cyclobutylphenyl)-thiomorpholin-3-ylmethanone |
|---|---|
| PubChem CID | 114607772 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (3-cyclobutylphenyl)-thiomorpholin-3-ylmethanone |
| SMILES | O=C(c1cccc(C2CCC2)c1)C1CSCCN1 |
| InChI | InChI=1S/C15H19NOS/c17-15(14-10-18-8-7-16-14)13-6-2-5-12(9-13)11-3-1-4-11/h2,5-6,9,11,14,16H,1,3-4,7-8,10H2 |
| InChIKey | XPODDMHRMHXPFA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |