C16H20O2 — CID 115814724
(3-cyclobutylphenyl)-(5-methyloxolan-2-yl)methanone (PubChem CID 115814724) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(5-methyloxolan-2-yl)methanone.
| Compound Name | (3-cyclobutylphenyl)-(5-methyloxolan-2-yl)methanone |
|---|---|
| PubChem CID | 115814724 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (3-cyclobutylphenyl)-(5-methyloxolan-2-yl)methanone |
| SMILES | CC1CCC(C(=O)c2cccc(C3CCC3)c2)O1 |
| InChI | InChI=1S/C16H20O2/c1-11-8-9-15(18-11)16(17)14-7-3-6-13(10-14)12-4-2-5-12/h3,6-7,10-12,15H,2,4-5,8-9H2,1H3 |
| InChIKey | JESONUVFLXLMHW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |