C14H12F2N2O3 — CID 114608561
2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]amino]benzoic acid (PubChem CID 114608561) has the molecular formula C14H12F2N2O3 and a molecular weight of 294.26 g/mol. Its IUPAC name is 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 114608561 |
| Molecular Formula | C14H12F2N2O3 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)c1cccn1CC(F)F |
| InChI | InChI=1S/C14H12F2N2O3/c15-12(16)8-18-7-3-6-11(18)13(19)17-10-5-2-1-4-9(10)14(20)21/h1-7,12H,8H2,(H,17,19)(H,20,21) |
| InChIKey | CZDOHYZNWSPQMY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |