C14H19BrOS — CID 11461194
(Z)-2-bromo-3,4,4-trimethyl-1-phenylsulfanylpent-1-en-3-ol (PubChem CID 11461194) has the molecular formula C14H19BrOS and a molecular weight of 315.28 g/mol. Its IUPAC name is (Z)-2-bromo-3,4,4-trimethyl-1-phenylsulfanylpent-1-en-3-ol.
| Compound Name | (Z)-2-bromo-3,4,4-trimethyl-1-phenylsulfanylpent-1-en-3-ol |
|---|---|
| PubChem CID | 11461194 |
| Molecular Formula | C14H19BrOS |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | (Z)-2-bromo-3,4,4-trimethyl-1-phenylsulfanylpent-1-en-3-ol |
| SMILES | CC(C)(C)C(C)(O)/C(Br)=C/Sc1ccccc1 |
| InChI | InChI=1S/C14H19BrOS/c1-13(2,3)14(4,16)12(15)10-17-11-8-6-5-7-9-11/h5-10,16H,1-4H3/b12-10- |
| InChIKey | WRABFMMYGQRDRJ-BENRWUELSA-N |
| XLogP | 4.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |