C19H29BrOS — CID 11474616
6-[(Z)-1-bromo-2-phenylsulfanylethenyl]undecan-6-ol (PubChem CID 11474616) has the molecular formula C19H29BrOS and a molecular weight of 385.41 g/mol. Its IUPAC name is 6-[(Z)-1-bromo-2-phenylsulfanylethenyl]undecan-6-ol.
| Compound Name | 6-[(Z)-1-bromo-2-phenylsulfanylethenyl]undecan-6-ol |
|---|---|
| PubChem CID | 11474616 |
| Molecular Formula | C19H29BrOS |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 6-[(Z)-1-bromo-2-phenylsulfanylethenyl]undecan-6-ol |
| SMILES | CCCCCC(O)(CCCCC)/C(Br)=C/Sc1ccccc1 |
| InChI | InChI=1S/C19H29BrOS/c1-3-5-10-14-19(21,15-11-6-4-2)18(20)16-22-17-12-8-7-9-13-17/h7-9,12-13,16,21H,3-6,10-11,14-15H2,1-2H3/b18-16- |
| InChIKey | MBQHIRFKERPGLN-VLGSPTGOSA-N |
| XLogP | 6.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|