C19H24O4 — CID 11461239
2,2-dimethyl-5-[1-(3-methylphenyl)cyclohexyl]-1,3-dioxane-4,6-dione (PubChem CID 11461239) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2,2-dimethyl-5-[1-(3-methylphenyl)cyclohexyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[1-(3-methylphenyl)cyclohexyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11461239 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2,2-dimethyl-5-[1-(3-methylphenyl)cyclohexyl]-1,3-dioxane-4,6-dione |
| SMILES | Cc1cccc(C2(C3C(=O)OC(C)(C)OC3=O)CCCCC2)c1 |
| InChI | InChI=1S/C19H24O4/c1-13-8-7-9-14(12-13)19(10-5-4-6-11-19)15-16(20)22-18(2,3)23-17(15)21/h7-9,12,15H,4-6,10-11H2,1-3H3 |
| InChIKey | JUCHVYUNHPAVEP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|