C12H17N3O3S2 — CID 114614163
5-(2-ethylmorpholin-4-yl)sulfonylpyridine-2-carbothioamide (PubChem CID 114614163) has the molecular formula C12H17N3O3S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 5-(2-ethylmorpholin-4-yl)sulfonylpyridine-2-carbothioamide.
| Compound Name | 5-(2-ethylmorpholin-4-yl)sulfonylpyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614163 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-(2-ethylmorpholin-4-yl)sulfonylpyridine-2-carbothioamide |
| SMILES | CCC1CN(S(=O)(=O)c2ccc(C(N)=S)nc2)CCO1 |
| InChI | InChI=1S/C12H17N3O3S2/c1-2-9-8-15(5-6-18-9)20(16,17)10-3-4-11(12(13)19)14-7-10/h3-4,7,9H,2,5-6,8H2,1H3,(H2,13,19) |
| InChIKey | LNSVIUQLYAPGQU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|