C10H13N3O4S2 — CID 106669527
5-(3,4-dihydroxypyrrolidin-1-yl)sulfonylpyridine-2-carbothioamide (PubChem CID 106669527) has the molecular formula C10H13N3O4S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 5-(3,4-dihydroxypyrrolidin-1-yl)sulfonylpyridine-2-carbothioamide.
| Compound Name | 5-(3,4-dihydroxypyrrolidin-1-yl)sulfonylpyridine-2-carbothioamide |
|---|---|
| PubChem CID | 106669527 |
| Molecular Formula | C10H13N3O4S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 5-(3,4-dihydroxypyrrolidin-1-yl)sulfonylpyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)N2CC(O)C(O)C2)cn1 |
| InChI | InChI=1S/C10H13N3O4S2/c11-10(18)7-2-1-6(3-12-7)19(16,17)13-4-8(14)9(15)5-13/h1-3,8-9,14-15H,4-5H2,(H2,11,18) |
| InChIKey | CIXPWFYPKCHVBJ-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|