C10H13N3O4S3 — CID 114614175
5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]pyridine-2-carbothioamide (PubChem CID 114614175) has the molecular formula C10H13N3O4S3 and a molecular weight of 335.43 g/mol. Its IUPAC name is 5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]pyridine-2-carbothioamide.
| Compound Name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614175 |
| Molecular Formula | C10H13N3O4S3 |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)N2CCS(=O)(=O)CC2)cn1 |
| InChI | InChI=1S/C10H13N3O4S3/c11-10(18)9-2-1-8(7-12-9)20(16,17)13-3-5-19(14,15)6-4-13/h1-2,7H,3-6H2,(H2,11,18) |
| InChIKey | JMCOZWQVDQIWNR-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|