C11H14N4O3S2 — CID 114614439
5-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]pyridine-2-carbothioamide (PubChem CID 114614439) has the molecular formula C11H14N4O3S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]pyridine-2-carbothioamide.
| Compound Name | 5-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614439 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-[(5-oxo-1,4-diazepan-1-yl)sulfonyl]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)N2CCNC(=O)CC2)cn1 |
| InChI | InChI=1S/C11H14N4O3S2/c12-11(19)9-2-1-8(7-14-9)20(17,18)15-5-3-10(16)13-4-6-15/h1-2,7H,3-6H2,(H2,12,19)(H,13,16) |
| InChIKey | KBWOVGMNRBWJPU-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|