C11H16N4O3S — CID 106594478
1-[[2-(aminomethyl)-3-pyridinyl]sulfonyl]-1,4-diazepan-5-one (PubChem CID 106594478) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[[2-(aminomethyl)-3-pyridinyl]sulfonyl]-1,4-diazepan-5-one.
| Compound Name | 1-[[2-(aminomethyl)-3-pyridinyl]sulfonyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 106594478 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-[[2-(aminomethyl)-3-pyridinyl]sulfonyl]-1,4-diazepan-5-one |
| SMILES | NCc1ncccc1S(=O)(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C11H16N4O3S/c12-8-9-10(2-1-4-13-9)19(17,18)15-6-3-11(16)14-5-7-15/h1-2,4H,3,5-8,12H2,(H,14,16) |
| InChIKey | KCIPKFJDMAXLRU-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |