C11H13FN2O — CID 114614947
3-amino-5-fluoro-N-(2-methylprop-2-enyl)benzamide (PubChem CID 114614947) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is 3-amino-5-fluoro-N-(2-methylprop-2-enyl)benzamide.
| Compound Name | 3-amino-5-fluoro-N-(2-methylprop-2-enyl)benzamide |
|---|---|
| PubChem CID | 114614947 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-amino-5-fluoro-N-(2-methylprop-2-enyl)benzamide |
| SMILES | C=C(C)CNC(=O)c1cc(N)cc(F)c1 |
| InChI | InChI=1S/C11H13FN2O/c1-7(2)6-14-11(15)8-3-9(12)5-10(13)4-8/h3-5H,1,6,13H2,2H3,(H,14,15) |
| InChIKey | JRARRSLKCHCPGB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|