C12H17FN2 — CID 114616027
1-(2-fluorophenyl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine (PubChem CID 114616027) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine.
| Compound Name | 1-(2-fluorophenyl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114616027 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
| SMILES | C=C(C)CNC(CN)c1ccccc1F |
| InChI | InChI=1S/C12H17FN2/c1-9(2)8-15-12(7-14)10-5-3-4-6-11(10)13/h3-6,12,15H,1,7-8,14H2,2H3 |
| InChIKey | DKHKDFSBTPENNZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|