C12H16ClFN2 — CID 114616189
1-(3-chloro-4-fluorophenyl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine (PubChem CID 114616189) has the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114616189 |
| Molecular Formula | C12H16ClFN2 |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
| SMILES | C=C(C)CNC(CN)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClFN2/c1-8(2)7-16-12(6-15)9-3-4-11(14)10(13)5-9/h3-5,12,16H,1,6-7,15H2,2H3 |
| InChIKey | ZIRZSTQIMBOYKQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|