C12H20N2O — CID 114616165
1-(5-ethylfuran-2-yl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine (PubChem CID 114616165) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(5-ethylfuran-2-yl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine.
| Compound Name | 1-(5-ethylfuran-2-yl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114616165 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(5-ethylfuran-2-yl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
| SMILES | C=C(C)CNC(CN)c1ccc(CC)o1 |
| InChI | InChI=1S/C12H20N2O/c1-4-10-5-6-12(15-10)11(7-13)14-8-9(2)3/h5-6,11,14H,2,4,7-8,13H2,1,3H3 |
| InChIKey | KVHSQGJNKPDQRV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|