C17H26N2O2 — CID 114616183
1-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine (PubChem CID 114616183) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine.
| Compound Name | 1-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114616183 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-N-(2-methylprop-2-enyl)ethane-1,2-diamine |
| SMILES | C=C(C)CNC(CN)c1cc2c(cc1OCC)CC(C)O2 |
| InChI | InChI=1S/C17H26N2O2/c1-5-20-17-7-13-6-12(4)21-16(13)8-14(17)15(9-18)19-10-11(2)3/h7-8,12,15,19H,2,5-6,9-10,18H2,1,3-4H3 |
| InChIKey | PTZAAJGMBHVACJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|