C7H13N3 — CID 114616713
N-(2-methylprop-2-enyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 114616713) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(2-methylprop-2-enyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 114616713 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N-(2-methylprop-2-enyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C=C(C)CNC1=NCCN1 |
| InChI | InChI=1S/C7H13N3/c1-6(2)5-10-7-8-3-4-9-7/h1,3-5H2,2H3,(H2,8,9,10) |
| InChIKey | KONAJXOMPLCIJC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|