C8H15N3 — CID 91169175
N-(2-methylidenebutyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 91169175) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N-(2-methylidenebutyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(2-methylidenebutyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 91169175 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N-(2-methylidenebutyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C=C(CC)CNC1=NCCN1 |
| InChI | InChI=1S/C8H15N3/c1-3-7(2)6-11-8-9-4-5-10-8/h2-6H2,1H3,(H2,9,10,11) |
| InChIKey | RNGDXLRZYJTOER-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|