C9H17N3 — CID 126987116
N-(2-methylidenebutyl)-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 126987116) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is N-(2-methylidenebutyl)-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-(2-methylidenebutyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 126987116 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-(2-methylidenebutyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C=C(CC)CNC1=NCCCN1 |
| InChI | InChI=1S/C9H17N3/c1-3-8(2)7-12-9-10-5-4-6-11-9/h2-7H2,1H3,(H2,10,11,12) |
| InChIKey | LSLYZRZFYPGXEQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|