C11H21N3 — CID 91369226
1,2-bis(3-methylbut-3-enyl)guanidine (PubChem CID 91369226) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1,2-bis(3-methylbut-3-enyl)guanidine.
| Compound Name | 1,2-bis(3-methylbut-3-enyl)guanidine |
|---|---|
| PubChem CID | 91369226 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1,2-bis(3-methylbut-3-enyl)guanidine |
| SMILES | C=C(C)CC/N=C(\N)NCCC(=C)C |
| InChI | InChI=1S/C11H21N3/c1-9(2)5-7-13-11(12)14-8-6-10(3)4/h1,3,5-8H2,2,4H3,(H3,12,13,14) |
| InChIKey | RTWCHSKXNOOIOU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|