C9H23N3 — CID 142877495
1,2-dimethyl-3-(4-methylpent-4-enyl)guanidine;molecular hydrogen (PubChem CID 142877495) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is 1,2-dimethyl-3-(4-methylpent-4-enyl)guanidine;molecular hydrogen.
| Compound Name | 1,2-dimethyl-3-(4-methylpent-4-enyl)guanidine;molecular hydrogen |
|---|---|
| PubChem CID | 142877495 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | 1,2-dimethyl-3-(4-methylpent-4-enyl)guanidine;molecular hydrogen |
| SMILES | C=C(C)CCCN/C(=N/C)NC.[H][H].[H][H] |
| InChI | InChI=1S/C9H19N3.2H2/c1-8(2)6-5-7-12-9(10-3)11-4;;/h1,5-7H2,2-4H3,(H2,10,11,12);2*1H |
| InChIKey | DVGLHVYDFRFHTC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|