C10H16N2O — CID 114616816
2-(2-methylprop-2-enylamino)-N-prop-2-ynylpropanamide (PubChem CID 114616816) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylamino)-N-prop-2-ynylpropanamide.
| Compound Name | 2-(2-methylprop-2-enylamino)-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 114616816 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-(2-methylprop-2-enylamino)-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)NCC(=C)C |
| InChI | InChI=1S/C10H16N2O/c1-5-6-11-10(13)9(4)12-7-8(2)3/h1,9,12H,2,6-7H2,3-4H3,(H,11,13) |
| InChIKey | ONLQOQZINHTQSV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|