C7H12N2O2 — CID 60721257
2-(methoxyamino)-N-prop-2-ynylpropanamide (PubChem CID 60721257) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-(methoxyamino)-N-prop-2-ynylpropanamide.
| Compound Name | 2-(methoxyamino)-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 60721257 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-(methoxyamino)-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)NOC |
| InChI | InChI=1S/C7H12N2O2/c1-4-5-8-7(10)6(2)9-11-3/h1,6,9H,5H2,2-3H3,(H,8,10) |
| InChIKey | WOKMLCNNHAYYEV-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|