C11H20N2O2 — CID 79249900
2-[(1-hydroxy-3-methylbutan-2-yl)amino]-N-prop-2-ynylpropanamide (PubChem CID 79249900) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[(1-hydroxy-3-methylbutan-2-yl)amino]-N-prop-2-ynylpropanamide.
| Compound Name | 2-[(1-hydroxy-3-methylbutan-2-yl)amino]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 79249900 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-[(1-hydroxy-3-methylbutan-2-yl)amino]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)NC(CO)C(C)C |
| InChI | InChI=1S/C11H20N2O2/c1-5-6-12-11(15)9(4)13-10(7-14)8(2)3/h1,8-10,13-14H,6-7H2,2-4H3,(H,12,15) |
| InChIKey | RBYCCMMVKNMFKA-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|