C18H17ClO4 — CID 11461735
methyl 2-[(5-chloro-2-phenylmethoxyphenyl)-hydroxymethyl]prop-2-enoate (PubChem CID 11461735) has the molecular formula C18H17ClO4 and a molecular weight of 332.78 g/mol. Its IUPAC name is methyl 2-[(5-chloro-2-phenylmethoxyphenyl)-hydroxymethyl]prop-2-enoate.
| Compound Name | methyl 2-[(5-chloro-2-phenylmethoxyphenyl)-hydroxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 11461735 |
| Molecular Formula | C18H17ClO4 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | methyl 2-[(5-chloro-2-phenylmethoxyphenyl)-hydroxymethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(O)c1cc(Cl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H17ClO4/c1-12(18(21)22-2)17(20)15-10-14(19)8-9-16(15)23-11-13-6-4-3-5-7-13/h3-10,17,20H,1,11H2,2H3 |
| InChIKey | UBNNHBDKWOREFS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|