C13H24N2O — CID 114620630
(1-cyclohex-2-en-1-yl-4-methoxypiperidin-2-yl)methanamine (PubChem CID 114620630) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (1-cyclohex-2-en-1-yl-4-methoxypiperidin-2-yl)methanamine.
| Compound Name | (1-cyclohex-2-en-1-yl-4-methoxypiperidin-2-yl)methanamine |
|---|---|
| PubChem CID | 114620630 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (1-cyclohex-2-en-1-yl-4-methoxypiperidin-2-yl)methanamine |
| SMILES | COC1CCN(C2C=CCCC2)C(CN)C1 |
| InChI | InChI=1S/C13H24N2O/c1-16-13-7-8-15(12(9-13)10-14)11-5-3-2-4-6-11/h3,5,11-13H,2,4,6-10,14H2,1H3 |
| InChIKey | BVWCLCHMWCEKGH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|