About (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine
(4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine (PubChem CID 163739102) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine.
Molecular Properties
| Compound Name | (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine |
| PubChem CID | 163739102 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine |
| SMILES | CO[C@H]1CC=C(N(CC2=CCC=CN2)C(C)C)CC1 |
| InChI | InChI=1S/C16H26N2O/c1-13(2)18(12-14-6-4-5-11-17-14)15-7-9-16(19-3)10-8-15/h5-7,11,13,16-17H,4,8-10,12H2,1-3H3/t16-/m0/s1 |
| InChIKey | LGFBTMQGSLEEFZ-INIZCTEOSA-N |
| XLogP | 3.17 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine?
The IUPAC name of (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine (CID 163739102) is (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine.
What is the SMILES notation for (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine?
The canonical SMILES for (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine is CO[C@H]1CC=C(N(CC2=CCC=CN2)C(C)C)CC1.
What is the InChIKey of (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine?
The InChIKey is LGFBTMQGSLEEFZ-INIZCTEOSA-N. The full InChI is InChI=1S/C16H26N2O/c1-13(2)18(12-14-6-4-5-11-17-14)15-7-9-16(19-3)10-8-15/h5-7,11,13,16-17H,4,8-10,12H2,1-3H3/t16-/m0/s1.
What are the key properties of (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine?
(4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine has a molecular weight of 262.40 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-N-(1,4-dihydropyridin-2-ylmethyl)-4-methoxy-N-propan-2-ylcyclohexen-1-amine is sourced from PubChem (CID 163739102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).