C16H22O5 — CID 114621017
5-methoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)oxybenzoic acid (PubChem CID 114621017) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-methoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)oxybenzoic acid.
| Compound Name | 5-methoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 114621017 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 5-methoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)oxybenzoic acid |
| SMILES | COc1ccc(OC2CC(C)(C)OC2(C)C)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H22O5/c1-15(2)9-13(16(3,4)21-15)20-12-7-6-10(19-5)8-11(12)14(17)18/h6-8,13H,9H2,1-5H3,(H,17,18) |
| InChIKey | WDRQFNKETBLRKP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |