C15H23NO4S — CID 114621747
5-methyl-2-(2,2,5,5-tetramethyloxolan-3-yl)oxybenzenesulfonamide (PubChem CID 114621747) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 5-methyl-2-(2,2,5,5-tetramethyloxolan-3-yl)oxybenzenesulfonamide.
| Compound Name | 5-methyl-2-(2,2,5,5-tetramethyloxolan-3-yl)oxybenzenesulfonamide |
|---|---|
| PubChem CID | 114621747 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-methyl-2-(2,2,5,5-tetramethyloxolan-3-yl)oxybenzenesulfonamide |
| SMILES | Cc1ccc(OC2CC(C)(C)OC2(C)C)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H23NO4S/c1-10-6-7-11(12(8-10)21(16,17)18)19-13-9-14(2,3)20-15(13,4)5/h6-8,13H,9H2,1-5H3,(H2,16,17,18) |
| InChIKey | MPIMGZBDMJQVSX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |