C15H20ClFO2 — CID 107691461
3-[4-(chloromethyl)-2-fluorophenoxy]-2,2,5,5-tetramethyloxolane (PubChem CID 107691461) has the molecular formula C15H20ClFO2 and a molecular weight of 286.77 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-2-fluorophenoxy]-2,2,5,5-tetramethyloxolane.
| Compound Name | 3-[4-(chloromethyl)-2-fluorophenoxy]-2,2,5,5-tetramethyloxolane |
|---|---|
| PubChem CID | 107691461 |
| Molecular Formula | C15H20ClFO2 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-[4-(chloromethyl)-2-fluorophenoxy]-2,2,5,5-tetramethyloxolane |
| SMILES | CC1(C)CC(Oc2ccc(CCl)cc2F)C(C)(C)O1 |
| InChI | InChI=1S/C15H20ClFO2/c1-14(2)8-13(15(3,4)19-14)18-12-6-5-10(9-16)7-11(12)17/h5-7,13H,8-9H2,1-4H3 |
| InChIKey | DKTLXSQQNQXGLR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|