C16H22Cl2O3 — CID 114621665
3-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]-2,2,5,5-tetramethyloxolane (PubChem CID 114621665) has the molecular formula C16H22Cl2O3 and a molecular weight of 333.26 g/mol. Its IUPAC name is 3-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]-2,2,5,5-tetramethyloxolane.
| Compound Name | 3-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]-2,2,5,5-tetramethyloxolane |
|---|---|
| PubChem CID | 114621665 |
| Molecular Formula | C16H22Cl2O3 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 3-[2-chloro-4-(chloromethyl)-6-methoxyphenoxy]-2,2,5,5-tetramethyloxolane |
| SMILES | COc1cc(CCl)cc(Cl)c1OC1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C16H22Cl2O3/c1-15(2)8-13(16(3,4)21-15)20-14-11(18)6-10(9-17)7-12(14)19-5/h6-7,13H,8-9H2,1-5H3 |
| InChIKey | DAYNNTULPIXHMU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|