C14H17BrF2O2 — CID 107098657
3-(5-bromo-2,3-difluorophenoxy)-2,2,5,5-tetramethyloxolane (PubChem CID 107098657) has the molecular formula C14H17BrF2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 3-(5-bromo-2,3-difluorophenoxy)-2,2,5,5-tetramethyloxolane.
| Compound Name | 3-(5-bromo-2,3-difluorophenoxy)-2,2,5,5-tetramethyloxolane |
|---|---|
| PubChem CID | 107098657 |
| Molecular Formula | C14H17BrF2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 3-(5-bromo-2,3-difluorophenoxy)-2,2,5,5-tetramethyloxolane |
| SMILES | CC1(C)CC(Oc2cc(Br)cc(F)c2F)C(C)(C)O1 |
| InChI | InChI=1S/C14H17BrF2O2/c1-13(2)7-11(14(3,4)19-13)18-10-6-8(15)5-9(16)12(10)17/h5-6,11H,7H2,1-4H3 |
| InChIKey | XVUCTBUVJBGJLC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|