C17H20ClFO2 — CID 114623612
3-[2-(3-chloroprop-1-ynyl)-5-fluorophenoxy]-2,2,5,5-tetramethyloxolane (PubChem CID 114623612) has the molecular formula C17H20ClFO2 and a molecular weight of 310.80 g/mol. Its IUPAC name is 3-[2-(3-chloroprop-1-ynyl)-5-fluorophenoxy]-2,2,5,5-tetramethyloxolane.
| Compound Name | 3-[2-(3-chloroprop-1-ynyl)-5-fluorophenoxy]-2,2,5,5-tetramethyloxolane |
|---|---|
| PubChem CID | 114623612 |
| Molecular Formula | C17H20ClFO2 |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-[2-(3-chloroprop-1-ynyl)-5-fluorophenoxy]-2,2,5,5-tetramethyloxolane |
| SMILES | CC1(C)CC(Oc2cc(F)ccc2C#CCCl)C(C)(C)O1 |
| InChI | InChI=1S/C17H20ClFO2/c1-16(2)11-15(17(3,4)21-16)20-14-10-13(19)8-7-12(14)6-5-9-18/h7-8,10,15H,9,11H2,1-4H3 |
| InChIKey | BTBQCRQSAHCFLN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|