C17H22FNO2 — CID 114623621
3-[2-fluoro-4-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]prop-2-yn-1-amine (PubChem CID 114623621) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is 3-[2-fluoro-4-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]prop-2-yn-1-amine.
| Compound Name | 3-[2-fluoro-4-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 114623621 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-[2-fluoro-4-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]prop-2-yn-1-amine |
| SMILES | CC1(C)CC(Oc2ccc(C#CCN)c(F)c2)C(C)(C)O1 |
| InChI | InChI=1S/C17H22FNO2/c1-16(2)11-15(17(3,4)21-16)20-13-8-7-12(6-5-9-19)14(18)10-13/h7-8,10,15H,9,11,19H2,1-4H3 |
| InChIKey | HGWZLYWGTKGYMB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|