C16H23NO3 — CID 114620999
1-[5-amino-2-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]ethanone (PubChem CID 114620999) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-[5-amino-2-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]ethanone.
| Compound Name | 1-[5-amino-2-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]ethanone |
|---|---|
| PubChem CID | 114620999 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 1-[5-amino-2-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]ethanone |
| SMILES | CC(=O)c1cc(N)ccc1OC1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C16H23NO3/c1-10(18)12-8-11(17)6-7-13(12)19-14-9-15(2,3)20-16(14,4)5/h6-8,14H,9,17H2,1-5H3 |
| InChIKey | QMRADBSODFUHHN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|