C15H20FNO3 — CID 114623752
(2,2,5,5-tetramethyloxolan-3-yl) 4-amino-2-fluorobenzoate (PubChem CID 114623752) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is (2,2,5,5-tetramethyloxolan-3-yl) 4-amino-2-fluorobenzoate.
| Compound Name | (2,2,5,5-tetramethyloxolan-3-yl) 4-amino-2-fluorobenzoate |
|---|---|
| PubChem CID | 114623752 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2,2,5,5-tetramethyloxolan-3-yl) 4-amino-2-fluorobenzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccc(N)cc2F)C(C)(C)O1 |
| InChI | InChI=1S/C15H20FNO3/c1-14(2)8-12(15(3,4)20-14)19-13(18)10-6-5-9(17)7-11(10)16/h5-7,12H,8,17H2,1-4H3 |
| InChIKey | RGYVJFNJDOJKQT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|