C16H23NO4 — CID 114623778
(2,2,5,5-tetramethyloxolan-3-yl) 3-amino-2-methoxybenzoate (PubChem CID 114623778) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (2,2,5,5-tetramethyloxolan-3-yl) 3-amino-2-methoxybenzoate.
| Compound Name | (2,2,5,5-tetramethyloxolan-3-yl) 3-amino-2-methoxybenzoate |
|---|---|
| PubChem CID | 114623778 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (2,2,5,5-tetramethyloxolan-3-yl) 3-amino-2-methoxybenzoate |
| SMILES | COc1c(N)cccc1C(=O)OC1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C16H23NO4/c1-15(2)9-12(16(3,4)21-15)20-14(18)10-7-6-8-11(17)13(10)19-5/h6-8,12H,9,17H2,1-5H3 |
| InChIKey | NMVJOSIQJBVEMJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|