C13H23N3O — CID 114621886
1-(2,2,5,5-tetramethyloxolan-3-yl)piperazine-2-carbonitrile (PubChem CID 114621886) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-(2,2,5,5-tetramethyloxolan-3-yl)piperazine-2-carbonitrile.
| Compound Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 114621886 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)piperazine-2-carbonitrile |
| SMILES | CC1(C)CC(N2CCNCC2C#N)C(C)(C)O1 |
| InChI | InChI=1S/C13H23N3O/c1-12(2)7-11(13(3,4)17-12)16-6-5-15-9-10(16)8-14/h10-11,15H,5-7,9H2,1-4H3 |
| InChIKey | AVVIEDVTOLWRSB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |