C14H26O3 — CID 114622044
oxan-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol (PubChem CID 114622044) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is oxan-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol.
| Compound Name | oxan-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol |
|---|---|
| PubChem CID | 114622044 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | oxan-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanol |
| SMILES | CC1(C)CC(C(O)C2CCCOC2)C(C)(C)O1 |
| InChI | InChI=1S/C14H26O3/c1-13(2)8-11(14(3,4)17-13)12(15)10-6-5-7-16-9-10/h10-12,15H,5-9H2,1-4H3 |
| InChIKey | OGLQAIWWLKAMRQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |