C10H16F2O2 — CID 131137680
(3,3-difluorocyclobutyl)-(oxan-3-yl)methanol (PubChem CID 131137680) has the molecular formula C10H16F2O2 and a molecular weight of 206.23 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-(oxan-3-yl)methanol.
| Compound Name | (3,3-difluorocyclobutyl)-(oxan-3-yl)methanol |
|---|---|
| PubChem CID | 131137680 |
| Molecular Formula | C10H16F2O2 |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3,3-difluorocyclobutyl)-(oxan-3-yl)methanol |
| SMILES | OC(C1CCCOC1)C1CC(F)(F)C1 |
| InChI | InChI=1S/C10H16F2O2/c11-10(12)4-8(5-10)9(13)7-2-1-3-14-6-7/h7-9,13H,1-6H2 |
| InChIKey | YUCRMOGOHCONHK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |